CAS 351003-39-9 is the registry number for Ethyl 8-methyl-4H-thieno[3,2-c]chromene-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 8-methyl-4H-thieno[3,2-c]chromene-2-carboxylate (CAS 351003-39-9) is a chemical compound with the molecular formula C15H14O3S and a molecular weight of 274.3 g/mol. IUPAC name: ethyl 8-methyl-4H-thieno[3,2-c]chromene-2-carboxylate. InChIKey: CKYQIEPRZRXATF-UHFFFAOYSA-N.
| Molecular formula | C15H14O3S |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | ethyl 8-methyl-4H-thieno[3,2-c]chromene-2-carboxylate |
| InChIKey | CKYQIEPRZRXATF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)C3=C(C=CC(=C3)C)OC2 |
Computed by PubChem (NCBI)