cas: 1002334-13-5 — see every product listed under this CAS number, including other names
1-Phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97%, 97% (CAS 1002334-13-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1112AK-100mg |
| cas | 1002334-13-5 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 731.60 Pln | |
| Chemat | 5g | 2829.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1002334-13-5) is a chemical compound with the molecular formula C15H19BN2O2 and a molecular weight of 270.14 g/mol. IUPAC name: 1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: UBYYGXCGPBWGKO-UHFFFAOYSA-N.
| Molecular formula | C15H19BN2O2 |
|---|---|
| Molecular weight | 270.14 g/mol |
| IUPAC name | 1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | UBYYGXCGPBWGKO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)