cas: 161952-26-7 — see every product listed under this CAS number, including other names
1-Phenyl-3-(thiophen-2-yl)-1H-pyrazol-5-amine, 98%, 98% (CAS 161952-26-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120M07-50mg |
| cas | 161952-26-7 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 371.60 Pln | |
| Chemat | 100mg | 592.40 Pln | |
| Chemat | 250mg | 861.20 Pln | |
| Chemat | 500mg | 1658.00 Pln | |
| Chemat | 1g | 1902.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-phenyl-3-thiophen-2-ylpyrazol-5-amine (CAS 161952-26-7) is a chemical compound with the molecular formula C13H11N3S and a molecular weight of 241.31 g/mol. IUPAC name: 1-phenyl-3-thiophen-2-ylpyrazol-5-amine. InChIKey: BZGSXFFNBNQVJN-UHFFFAOYSA-N.
| Molecular formula | C13H11N3S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 1-phenyl-3-thiophen-2-ylpyrazol-5-amine |
| InChIKey | BZGSXFFNBNQVJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=CC(=N2)C3=CC=CS3)N |
Computed by PubChem (NCBI)