CAS 638211-90-2 is the registry number for N-(Pyridin-2-ylmethyl)-1,3-benzothiazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-(pyridin-2-ylmethyl)-1,3-benzothiazol-2-amine (CAS 638211-90-2) is a chemical compound with the molecular formula C13H11N3S and a molecular weight of 241.31 g/mol. IUPAC name: N-(pyridin-2-ylmethyl)-1,3-benzothiazol-2-amine. InChIKey: MNMLDERTJCOFJS-UHFFFAOYSA-N.
| Molecular formula | C13H11N3S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | N-(pyridin-2-ylmethyl)-1,3-benzothiazol-2-amine |
| InChIKey | MNMLDERTJCOFJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)NCC3=CC=CC=N3 |
Computed by PubChem (NCBI)