CAS 61532-31-8 is the registry number for 3-Benzyl-1,3-dihydro-2H-imidazo[4,5-b]pyridine-2-thione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-benzyl-1H-imidazo[4,5-b]pyridine-2-thione (CAS 61532-31-8) is a chemical compound with the molecular formula C13H11N3S and a molecular weight of 241.31 g/mol. IUPAC name: 3-benzyl-1H-imidazo[4,5-b]pyridine-2-thione. InChIKey: SMEKGSJXVOATCK-UHFFFAOYSA-N.
| Molecular formula | C13H11N3S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 3-benzyl-1H-imidazo[4,5-b]pyridine-2-thione |
| InChIKey | SMEKGSJXVOATCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=CC=N3)NC2=S |
Computed by PubChem (NCBI)