cas: 381725-50-4 — see every product listed under this CAS number, including other names
1-Phenyl-5-(pyridin-2-yl)-2(1H)-pyridone, 98% (CAS 381725-50-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F601256-250MG |
| cas | 381725-50-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 612.30 Pln | |
| Fluorochem | 5g | 1945.17 Pln | |
| Fluorochem | 25g | 6755.97 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-phenyl-5-pyridin-2-ylpyridin-2-one (CAS 381725-50-4) is a chemical compound with the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. IUPAC name: 1-phenyl-5-pyridin-2-ylpyridin-2-one. InChIKey: JHBMGQOABUXDND-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 1-phenyl-5-pyridin-2-ylpyridin-2-one |
| InChIKey | JHBMGQOABUXDND-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C=CC2=O)C3=CC=CC=N3 |
Computed by PubChem (NCBI)