Products 18591-57-6
CAS 18591-57-6 appears in our catalog under these names: Selexipag Impurity 10, 5，6–diphenyl–1H–pyrazin–2–one, 5,6-Diphenylpyrazinol, 5,6-Diphenylpyrazin-2-ol 97%, 5,6-Diphenylpyrazin-2-ol, 97%, 97%. Offered by: Chemat Brand, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 50g, 1g, 5g, 10g, 25g, 100g.
5,6-diphenyl-1H-pyrazin-2-one (CAS 18591-57-6) is a chemical compound with the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. IUPAC name: 5,6-diphenyl-1H-pyrazin-2-one. InChIKey: LTWBZUZTTUVPIM-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 5,6-diphenyl-1H-pyrazin-2-one |
| InChIKey | LTWBZUZTTUVPIM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=CC(=O)N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)