cas: 2201-23-2 — see every product listed under this CAS number, including other names
1-Phenylcyclohexanecarbonitrile, 95%, 95% (CAS 2201-23-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BCDE-1g |
| cas | 2201-23-2 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 410.00 Pln | |
| Chemat | 25g | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-phenylcyclohexane-1-carbonitrile (CAS 2201-23-2) is a chemical compound with the molecular formula C13H15N and a molecular weight of 185.26 g/mol. IUPAC name: 1-phenylcyclohexane-1-carbonitrile. InChIKey: AUXIEQKHXAYAHG-UHFFFAOYSA-N.
| Molecular formula | C13H15N |
|---|---|
| Molecular weight | 185.26 g/mol |
| IUPAC name | 1-phenylcyclohexane-1-carbonitrile |
| InChIKey | AUXIEQKHXAYAHG-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C#N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)