CAS 68141-13-9 appears in our catalog under these names: 6-tert-Butylquinoline, 95%, 6–tert–Butylquinoline, 6-tert-Butylquinoline, >98.0%(GC)(T), 6-tert-Butylquinoline, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 1g, 200mg, 100mg, 5g, 10g.
6-tert-butylquinoline (CAS 68141-13-9) is a chemical compound with the molecular formula C13H15N and a molecular weight of 185.26 g/mol. IUPAC name: 6-tert-butylquinoline. InChIKey: JHAWWJQGHKGXHA-UHFFFAOYSA-N.
| Molecular formula | C13H15N |
|---|---|
| Molecular weight | 185.26 g/mol |
| IUPAC name | 6-tert-butylquinoline |
| InChIKey | JHAWWJQGHKGXHA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)N=CC=C2 |
Computed by PubChem (NCBI)