CAS 32411-27-1 is the registry number for 2,5-Dimethyl-1-p-tolyl-1h-pyrrole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
2,5-dimethyl-1-(4-methylphenyl)pyrrole (CAS 32411-27-1) is a chemical compound with the molecular formula C13H15N and a molecular weight of 185.26 g/mol. IUPAC name: 2,5-dimethyl-1-(4-methylphenyl)pyrrole. InChIKey: SWIUPUUNVWDJED-UHFFFAOYSA-N.
| Molecular formula | C13H15N |
|---|---|
| Molecular weight | 185.26 g/mol |
| IUPAC name | 2,5-dimethyl-1-(4-methylphenyl)pyrrole |
| InChIKey | SWIUPUUNVWDJED-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=CC=C2C)C |
Computed by PubChem (NCBI)