1-Phenylpiperidin-2-one, 98%
cas: 4789-09-7 — see every product listed under this CAS number, including other names
1-Phenylpiperidin-2-one, 98% (CAS 4789-09-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A145029-250mg |
| cas | 4789-09-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 948.88 Pln | |
| Ambeed | 5g | 3151.62 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 425.43 Pln | |
| BLDpharm | 1g | 1019.67 Pln | |
| BLDpharm | 5g | 3391.05 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 914.28 Pln | |
| Fluorochem | 100mg | 289.50 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-phenylpiperidin-2-one (CAS 4789-09-7) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 1-phenylpiperidin-2-one. InChIKey: NKOGCJIYHZVBDR-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 1-phenylpiperidin-2-one |
| InChIKey | NKOGCJIYHZVBDR-UHFFFAOYSA-N |
| SMILES | C1CCN(C(=O)C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)