CAS 4789-09-7 appears in our catalog under these names: 1-Phenyl-2-piperidinone, 95-<97%, 1-Phenyl-2-piperidinone, ≥97-<99%, 1–Phenylpiperidin–2–one, 1-Phenylpiperidin-2-one 98%. Offered by: Hoffman Fine Chemicals, GLPBio, Ambeed. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 100mg, 250mg, 1g.
1-phenylpiperidin-2-one (CAS 4789-09-7) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 1-phenylpiperidin-2-one. InChIKey: NKOGCJIYHZVBDR-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 1-phenylpiperidin-2-one |
| InChIKey | NKOGCJIYHZVBDR-UHFFFAOYSA-N |
| SMILES | C1CCN(C(=O)C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)