cas: 206879-72-3 — see every product listed under this CAS number, including other names
1-Piperazinecarboxylic acid, 4-(3-aminophenyl)-, 1,1-dimethylethyl ester, 98%, 98% (CAS 206879-72-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113IQ2-100mg |
| cas | 206879-72-3 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 496.40 Pln | |
| Chemat | 25g | 2142.80 Pln | |
| Chemat | 100g | 6722.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(3-aminophenyl)piperazine-1-carboxylate (CAS 206879-72-3) is a chemical compound with the molecular formula C15H23N3O2 and a molecular weight of 277.36 g/mol. IUPAC name: tert-butyl 4-(3-aminophenyl)piperazine-1-carboxylate. InChIKey: GCSOXUVISUKQBS-UHFFFAOYSA-N.
| Molecular formula | C15H23N3O2 |
|---|---|
| Molecular weight | 277.36 g/mol |
| IUPAC name | tert-butyl 4-(3-aminophenyl)piperazine-1-carboxylate |
| InChIKey | GCSOXUVISUKQBS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)