CAS 1330754-01-2 is the registry number for 2-tert-Butyl-5,7-dihydro-pyrrolo[3,4-d]pyrimidine-6-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Tert-butyl 2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate (CAS 1330754-01-2) is a chemical compound with the molecular formula C15H23N3O2 and a molecular weight of 277.36 g/mol. IUPAC name: tert-butyl 2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate. InChIKey: BKRUKVNOWPWHQO-UHFFFAOYSA-N.
| Molecular formula | C15H23N3O2 |
|---|---|
| Molecular weight | 277.36 g/mol |
| IUPAC name | tert-butyl 2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate |
| InChIKey | BKRUKVNOWPWHQO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC=C2CN(CC2=N1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)