Products 1159976-32-5

CAS 1159976-32-5 is the registry number for 3-[(4-Amino-phenylamino)-pyrrolidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 3-(4-aminoanilino)pyrrolidine-1-carboxylate (CAS 1159976-32-5) is a chemical compound with the molecular formula C15H23N3O2 and a molecular weight of 277.36 g/mol. IUPAC name: tert-butyl 3-(4-aminoanilino)pyrrolidine-1-carboxylate. InChIKey: SCQCXXWVNOKLOT-UHFFFAOYSA-N.

Identity
Molecular formulaC15H23N3O2
Molecular weight277.36 g/mol
IUPAC nametert-butyl 3-(4-aminoanilino)pyrrolidine-1-carboxylate
InChIKeySCQCXXWVNOKLOT-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(C1)NC2=CC=C(C=C2)N

Computed by PubChem (NCBI)