cas: 111247-60-0 — see every product listed under this CAS number, including other names
1-Pyrimidin-2-yl-piperidine-4-carboxylic acid ethyl ester (CAS 111247-60-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F027331-1G |
| cas | 111247-60-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 404.04 Pln | |
| Fluorochem | 10g | 674.78 Pln |
| delivery time | 2-3 weeks |
|---|
Ethyl 1-pyrimidin-2-ylpiperidine-4-carboxylate (CAS 111247-60-0) is a chemical compound with the molecular formula C12H17N3O2 and a molecular weight of 235.28 g/mol. IUPAC name: ethyl 1-pyrimidin-2-ylpiperidine-4-carboxylate. InChIKey: QMAXUUVHHTYNHC-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O2 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | ethyl 1-pyrimidin-2-ylpiperidine-4-carboxylate |
| InChIKey | QMAXUUVHHTYNHC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(CC1)C2=NC=CC=N2 |
Computed by PubChem (NCBI)