cas: 2043-00-7 — see every product listed under this CAS number, including other names
1-Styrylnaphthalene, 97%, 97% (CAS 2043-00-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1130EB-250mg |
| cas | 2043-00-7 |
| size | 250mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 477.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-[(E)-2-phenylethenyl]naphthalene (CAS 2043-00-7) is a chemical compound with the molecular formula C18H14 and a molecular weight of 230.3 g/mol. IUPAC name: 1-[(E)-2-phenylethenyl]naphthalene. InChIKey: QAVDMWIHZMXKFR-BUHFOSPRSA-N.
| Molecular formula | C18H14 |
|---|---|
| Molecular weight | 230.3 g/mol |
| IUPAC name | 1-[(E)-2-phenylethenyl]naphthalene |
| InChIKey | QAVDMWIHZMXKFR-BUHFOSPRSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)