CAS 84-15-1 appears in our catalog under these names: 1,1':2',1''-Terphenyl, 98%, 98%, 1,2-Diphenylbenzene, O-Terphenyl, >95% (HPLC), o-Terphenyl, o-Terphenyl 10000 µg/mL in Dichloromethane. Offered by: Chemat, Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio. Available pack sizes: 25g, 100g, on request, 10g, 5g, 100mg, 5x1ml, 500g.
1,2-diphenylbenzene (CAS 84-15-1) is a chemical compound with the molecular formula C18H14 and a molecular weight of 230.3 g/mol. IUPAC name: 1,2-diphenylbenzene. InChIKey: OIAQMFOKAXHPNH-UHFFFAOYSA-N.
| Molecular formula | C18H14 |
|---|---|
| Molecular weight | 230.3 g/mol |
| IUPAC name | 1,2-diphenylbenzene |
| InChIKey | OIAQMFOKAXHPNH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C3=CC=CC=C3 |
Computed by PubChem (NCBI)