CAS 2043-00-7 appears in our catalog under these names: 1-Styrylnaphthalene, 95%, 1-Styrylnaphthalene, 97%, 1-Styrylnaphthalene, 97%, 97%, 1-Styryl-naphthalene, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 25g, 5g.
1-[(E)-2-phenylethenyl]naphthalene (CAS 2043-00-7) is a chemical compound with the molecular formula C18H14 and a molecular weight of 230.3 g/mol. IUPAC name: 1-[(E)-2-phenylethenyl]naphthalene. InChIKey: QAVDMWIHZMXKFR-BUHFOSPRSA-N.
| Molecular formula | C18H14 |
|---|---|
| Molecular weight | 230.3 g/mol |
| IUPAC name | 1-[(E)-2-phenylethenyl]naphthalene |
| InChIKey | QAVDMWIHZMXKFR-BUHFOSPRSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)