cas: 495415-09-3 — see every product listed under this CAS number, including other names
1-Tert-Butyl 4-Methyl 4-Hydroxypiperidine-1,4-Dicarboxylate, 98%, 98% (CAS 495415-09-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140Y0-100mg |
| cas | 495415-09-3 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 500mg | 218.00 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 578.00 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1715.60 Pln | |
| Chemat | 50g | 3165.20 Pln | |
| Chemat | 100g | 5574.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 4-O-methyl 4-hydroxypiperidine-1,4-dicarboxylate (CAS 495415-09-3) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 4-hydroxypiperidine-1,4-dicarboxylate. InChIKey: WYFPECMSBUVNET-UHFFFAOYSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl 4-hydroxypiperidine-1,4-dicarboxylate |
| InChIKey | WYFPECMSBUVNET-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C(=O)OC)O |
Computed by PubChem (NCBI)