CAS 1447240-83-6 appears in our catalog under these names: Methyl n-boc-3-methylmorpholine-3-carboxylate, 97%, 4-(tert-Butyl) 3-methyl 3-methylmorpholine-3,4-dicarboxylate, 98+%, Methyl N–Boc–3–methylmorpholine–3–carboxylate, Methyl N-Boc-3-methylmorpholine-3-carboxylate. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,25g, 0,5g, 2g.
4-O-tert-butyl 3-O-methyl 3-methylmorpholine-3,4-dicarboxylate (CAS 1447240-83-6) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 4-O-tert-butyl 3-O-methyl 3-methylmorpholine-3,4-dicarboxylate. InChIKey: NAPZVCIFIQJJOJ-UHFFFAOYSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 4-O-tert-butyl 3-O-methyl 3-methylmorpholine-3,4-dicarboxylate |
| InChIKey | NAPZVCIFIQJJOJ-UHFFFAOYSA-N |
| SMILES | CC1(COCCN1C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)