cas: 17639-64-4 — see every product listed under this CAS number, including other names
1-Tosyl-1H-pyrrole 98% (CAS 17639-64-4) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A175752-1000g |
| cas | 17639-64-4 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 4091.69 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Ambeed | 100g | 909.94 Pln | |
| Ambeed | 500g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A175752 |
1-(4-methylphenyl)sulfonylpyrrole (CAS 17639-64-4) is a chemical compound with the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylpyrrole. InChIKey: OXWIEWFMRVJGNY-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2S |
|---|---|
| Molecular weight | 221.28 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylpyrrole |
| InChIKey | OXWIEWFMRVJGNY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC=C2 |
Computed by PubChem (NCBI)