CAS 41387-91-1 is the registry number for 4-Benzothiazol-2-yl-butyric acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
4-(1,3-benzothiazol-2-yl)butanoic acid (CAS 41387-91-1) is a chemical compound with the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. IUPAC name: 4-(1,3-benzothiazol-2-yl)butanoic acid. InChIKey: DOTLYHUQAIHKEV-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2S |
|---|---|
| Molecular weight | 221.28 g/mol |
| IUPAC name | 4-(1,3-benzothiazol-2-yl)butanoic acid |
| InChIKey | DOTLYHUQAIHKEV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)CCCC(=O)O |
Computed by PubChem (NCBI)