CAS 1956-23-6 appears in our catalog under these names: 3-(3-Benzothienyl)-dl-alanine, 95%, 2-Amino-3-(benzo(b)thiophen-3-yl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
(2S)-2-amino-3-(1-benzothiophen-3-yl)propanoic acid (CAS 1956-23-6) is a chemical compound with the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. IUPAC name: (2S)-2-amino-3-(1-benzothiophen-3-yl)propanoic acid. InChIKey: GAUUPDQWKHTCAX-VIFPVBQESA-N.
| Molecular formula | C11H11NO2S |
|---|---|
| Molecular weight | 221.28 g/mol |
| IUPAC name | (2S)-2-amino-3-(1-benzothiophen-3-yl)propanoic acid |
| InChIKey | GAUUPDQWKHTCAX-VIFPVBQESA-N |
| SMILES | C1=CC=C2C(=C1)C(=CS2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)