cas: 57502-57-5 — see every product listed under this CAS number, including other names
1-Tosyl-2,3,6,7-tetrahydro-1H-azepine, 95%, 95% (CAS 57502-57-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EK92-250mg |
| cas | 57502-57-5 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 2248.40 Pln | |
| Chemat | 1g | 4442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(4-methylphenyl)sulfonyl-2,3,6,7-tetrahydroazepine (CAS 57502-57-5) is a chemical compound with the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-2,3,6,7-tetrahydroazepine. InChIKey: NZLYCWGZDCVFJG-UHFFFAOYSA-N.
| Molecular formula | C13H17NO2S |
|---|---|
| Molecular weight | 251.35 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-2,3,6,7-tetrahydroazepine |
| InChIKey | NZLYCWGZDCVFJG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC=CCC2 |
Computed by PubChem (NCBI)