CAS 57502-57-5 appears in our catalog under these names: 1-Tosyl-2,3,6,7-tetrahydro-1h-azepine, 95%, 1–tosyl–2,3,6,7–tetrahydro–1H–azepine, 1-Tosyl-2,3,6,7-tetrahydro-1H-azepine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
1-(4-methylphenyl)sulfonyl-2,3,6,7-tetrahydroazepine (CAS 57502-57-5) is a chemical compound with the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-2,3,6,7-tetrahydroazepine. InChIKey: NZLYCWGZDCVFJG-UHFFFAOYSA-N.
| Molecular formula | C13H17NO2S |
|---|---|
| Molecular weight | 251.35 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-2,3,6,7-tetrahydroazepine |
| InChIKey | NZLYCWGZDCVFJG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC=CCC2 |
Computed by PubChem (NCBI)