Products 1320326-66-6
CAS 1320326-66-6 is the registry number for rel-(3aS,6aS)-5-Benzylhexahydro-2H-thieno[2,3-c]pyrrole 1,1-dioxide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(3aS,6aS)-5-benzyl-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide (CAS 1320326-66-6) is a chemical compound with the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. IUPAC name: (3aS,6aS)-5-benzyl-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide. InChIKey: VOUOUAFQWDNCSC-QWHCGFSZSA-N.
| Molecular formula | C13H17NO2S |
|---|---|
| Molecular weight | 251.35 g/mol |
| IUPAC name | (3aS,6aS)-5-benzyl-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide |
| InChIKey | VOUOUAFQWDNCSC-QWHCGFSZSA-N |
| SMILES | C1CS(=O)(=O)[C@H]2[C@@H]1CN(C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)