cas: 886497-75-2 — see every product listed under this CAS number, including other names
1-Tosylpiperidin-4-amine, 95+% (CAS 886497-75-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A468613-5g |
| cas | 886497-75-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 9210.04 Pln | |
| AmBeed | 10g | 13780.06 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(4-methylphenyl)sulfonylpiperidin-4-amine (CAS 886497-75-2) is a chemical compound with the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylpiperidin-4-amine. InChIKey: DSHYCTJDCZLVLE-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O2S |
|---|---|
| Molecular weight | 254.35 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylpiperidin-4-amine |
| InChIKey | DSHYCTJDCZLVLE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC(CC2)N |
Computed by PubChem (NCBI)