CAS 61886-26-8 is the registry number for N-Cyclohexyl 3-aminobenzenesulfonamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 500g, 5g, 100g, 1g.
3-amino-N-cyclohexylbenzenesulfonamide (CAS 61886-26-8) is a chemical compound with the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. IUPAC name: 3-amino-N-cyclohexylbenzenesulfonamide. InChIKey: DFMAKCBJDOFYEO-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O2S |
|---|---|
| Molecular weight | 254.35 g/mol |
| IUPAC name | 3-amino-N-cyclohexylbenzenesulfonamide |
| InChIKey | DFMAKCBJDOFYEO-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NS(=O)(=O)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)