CAS 91619-39-5 is the registry number for 3-(Azepane-1-sulfonyl)-phenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
3-(azepan-1-ylsulfonyl)aniline (CAS 91619-39-5) is a chemical compound with the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. IUPAC name: 3-(azepan-1-ylsulfonyl)aniline. InChIKey: OXDMSVNDLGEMFK-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O2S |
|---|---|
| Molecular weight | 254.35 g/mol |
| IUPAC name | 3-(azepan-1-ylsulfonyl)aniline |
| InChIKey | OXDMSVNDLGEMFK-UHFFFAOYSA-N |
| SMILES | C1CCCN(CC1)S(=O)(=O)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)