cas: 1260794-26-0 — see every product listed under this CAS number, including other names
1-chloroisoquinoline-4-carboxylic acid, 95+% (CAS 1260794-26-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A889694-1g |
| cas | 1260794-26-0 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6840.40 Pln | |
| AmBeed | 10g | 26005.84 Pln | |
| AmBeed | 5g | 19619.53 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-chloroisoquinoline-4-carboxylic acid (CAS 1260794-26-0) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 1-chloroisoquinoline-4-carboxylic acid. InChIKey: VAPWFBQHRVYUDV-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 1-chloroisoquinoline-4-carboxylic acid |
| InChIKey | VAPWFBQHRVYUDV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=C2Cl)C(=O)O |
Computed by PubChem (NCBI)