cas: 1260794-26-0 — see every product listed under this CAS number, including other names
1-chloroisoquinoline-4-carboxylic acid (CAS 1260794-26-0) is a chemical reagent available from Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 500mg. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | KAC79426-0,5g |
| cas | 1260794-26-0 |
| size | 0,5g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 0,5g | price on request | |
| Biosynth | 50mg | price on request | |
| Fluorochem | 50mg | 981.96 Pln | |
| Fluorochem | 100mg | 1127.75 Pln | |
| Fluorochem | 250mg | 2252.35 Pln | |
| Fluorochem | 500mg | 3689.34 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
1-chloroisoquinoline-4-carboxylic acid (CAS 1260794-26-0) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 1-chloroisoquinoline-4-carboxylic acid. InChIKey: VAPWFBQHRVYUDV-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 1-chloroisoquinoline-4-carboxylic acid |
| InChIKey | VAPWFBQHRVYUDV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=C2Cl)C(=O)O |
Computed by PubChem (NCBI)