cas: 1105663-96-4 — see every product listed under this CAS number, including other names
1-tert-Butyl 3-ethyl 3-cyanoazetidine-1,3-dicarboxylate, 97% (CAS 1105663-96-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F230003-100MG |
| cas | 1105663-96-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 820.56 Pln | |
| Fluorochem | 500mg | 1158.98 Pln | |
| Fluorochem | 1g | 1971.20 Pln | |
| Fluorochem | 5g | 5777.15 Pln | |
| Fluorochem | 10g | 11150.26 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-O-tert-butyl 3-O-ethyl 3-cyanoazetidine-1,3-dicarboxylate (CAS 1105663-96-4) is a chemical compound with the molecular formula C12H18N2O4 and a molecular weight of 254.28 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 3-cyanoazetidine-1,3-dicarboxylate. InChIKey: OZRWQLNFGSPWGB-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O4 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 3-cyanoazetidine-1,3-dicarboxylate |
| InChIKey | OZRWQLNFGSPWGB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CN(C1)C(=O)OC(C)(C)C)C#N |
Computed by PubChem (NCBI)