cas: 220223-46-1 — see every product listed under this CAS number, including other names
1-tert-Butyl 4-methyl 3-oxopiperidine-1,4-dicarboxylate, 97% (CAS 220223-46-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F220363-250MG |
| cas | 220223-46-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 966.34 Pln | |
| Fluorochem | 10g | 1794.18 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-O-tert-butyl 4-O-methyl 3-oxopiperidine-1,4-dicarboxylate (CAS 220223-46-1) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 3-oxopiperidine-1,4-dicarboxylate. InChIKey: MVZLAUYYGDJPEA-UHFFFAOYSA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl 3-oxopiperidine-1,4-dicarboxylate |
| InChIKey | MVZLAUYYGDJPEA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)C1)C(=O)OC |
Computed by PubChem (NCBI)