Products 1352721-92-6
CAS 1352721-92-6 is the registry number for (S)-1-(2-(tert-Butoxy)-2-oxoethyl)-4-oxopiperidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
(2S)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-oxopiperidine-2-carboxylic acid (CAS 1352721-92-6) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: (2S)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-oxopiperidine-2-carboxylic acid. InChIKey: OZAWLTYEPXIRGI-VIFPVBQESA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | (2S)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-oxopiperidine-2-carboxylic acid |
| InChIKey | OZAWLTYEPXIRGI-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)CN1CCC(=O)C[C@H]1C(=O)O |
Computed by PubChem (NCBI)