cas: 1256359-15-5 — see every product listed under this CAS number, including other names
1-tert-Butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 95% (CAS 1256359-15-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F050820-100MG |
| cas | 1256359-15-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 91.65 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 591.48 Pln | |
| Fluorochem | 10g | 1106.92 Pln | |
| Fluorochem | 25g | 1934.75 Pln | |
| Fluorochem | 50g | 3809.09 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-tert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1256359-15-5) is a chemical compound with the molecular formula C13H23BN2O2 and a molecular weight of 250.15 g/mol. IUPAC name: 1-tert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: MXAMURVMMKANFD-UHFFFAOYSA-N.
| Molecular formula | C13H23BN2O2 |
|---|---|
| Molecular weight | 250.15 g/mol |
| IUPAC name | 1-tert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | MXAMURVMMKANFD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C(C)(C)C |
Computed by PubChem (NCBI)