CAS 2223012-42-6 is the registry number for 1-(tert-Butyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-tert-butyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2223012-42-6) is a chemical compound with the molecular formula C13H23BN2O2 and a molecular weight of 250.15 g/mol. IUPAC name: 1-tert-butyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: LIYPKGKATARCEC-UHFFFAOYSA-N.
| Molecular formula | C13H23BN2O2 |
|---|---|
| Molecular weight | 250.15 g/mol |
| IUPAC name | 1-tert-butyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | LIYPKGKATARCEC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)