cas: 1274892-05-5 — see every product listed under this CAS number, including other names
10-Benzylamino-1-decanol, >98.0%(T) (CAS 1274892-05-5) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B2386-5G |
| cas | 1274892-05-5 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 664.16 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
10-(benzylamino)decan-1-ol (CAS 1274892-05-5) is a chemical compound with the molecular formula C17H29NO and a molecular weight of 263.4 g/mol. IUPAC name: 10-(benzylamino)decan-1-ol. InChIKey: PZKWYQBXXXKOOF-UHFFFAOYSA-N.
| Molecular formula | C17H29NO |
|---|---|
| Molecular weight | 263.4 g/mol |
| IUPAC name | 10-(benzylamino)decan-1-ol |
| InChIKey | PZKWYQBXXXKOOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNCCCCCCCCCCO |
Computed by PubChem (NCBI)