Products 19510-14-6

CAS 19510-14-6 is the registry number for Phenol, 4-(3-aminopropyl)-2,6-bis(1,1-dimethylethyl)-, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-(3-aminopropyl)-2,6-ditert-butylphenol (CAS 19510-14-6) is a chemical compound with the molecular formula C17H29NO and a molecular weight of 263.4 g/mol. IUPAC name: 4-(3-aminopropyl)-2,6-ditert-butylphenol. InChIKey: LUWJFAGOLNUTBA-UHFFFAOYSA-N.

Identity
Molecular formulaC17H29NO
Molecular weight263.4 g/mol
IUPAC name4-(3-aminopropyl)-2,6-ditert-butylphenol
InChIKeyLUWJFAGOLNUTBA-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CCCN

Computed by PubChem (NCBI)