cas: 1274892-05-5 — see every product listed under this CAS number, including other names
10-Benzylamino-1-decanol, ≥98%, ≥98% (CAS 1274892-05-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HRPF-250mg |
| cas | 1274892-05-5 |
| size | 250mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 5g | 1149.20 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
10-(benzylamino)decan-1-ol (CAS 1274892-05-5) is a chemical compound with the molecular formula C17H29NO and a molecular weight of 263.4 g/mol. IUPAC name: 10-(benzylamino)decan-1-ol. InChIKey: PZKWYQBXXXKOOF-UHFFFAOYSA-N.
| Molecular formula | C17H29NO |
|---|---|
| Molecular weight | 263.4 g/mol |
| IUPAC name | 10-(benzylamino)decan-1-ol |
| InChIKey | PZKWYQBXXXKOOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNCCCCCCCCCCO |
Computed by PubChem (NCBI)