cas: 750570-81-1 — see every product listed under this CAS number, including other names
12-Bromo-13-phenyl-10-thia-1,8-diazatricyclo(7.4.0.0,2,7)trideca-2,4,6,8-tetraene, 95% (CAS 750570-81-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1087427-10g |
| cas | 750570-81-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 16065.07 Pln | |
| AmBeed | 5g | 10733.38 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-4-phenyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazole (CAS 750570-81-1) is a chemical compound with the molecular formula C16H13BrN2S and a molecular weight of 345.3 g/mol. IUPAC name: 3-bromo-4-phenyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazole. InChIKey: XZVHYPKKENGTGN-UHFFFAOYSA-N.
| Molecular formula | C16H13BrN2S |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | 3-bromo-4-phenyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazole |
| InChIKey | XZVHYPKKENGTGN-UHFFFAOYSA-N |
| SMILES | C1C(C(N2C3=CC=CC=C3N=C2S1)C4=CC=CC=C4)Br |
Computed by PubChem (NCBI)