CAS 2309431-63-6 is the registry number for Rac-(12r,13r)-12-bromo-13-phenyl-10-thia-1,8-diazatricyclo[7.4.0.0,2,7]trideca-2(7),3,5,8-tetraene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
(3S,4S)-3-bromo-4-phenyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazole (CAS 2309431-63-6) is a chemical compound with the molecular formula C16H13BrN2S and a molecular weight of 345.3 g/mol. IUPAC name: (3S,4S)-3-bromo-4-phenyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazole. InChIKey: XZVHYPKKENGTGN-DOMZBBRYSA-N.
| Molecular formula | C16H13BrN2S |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | (3S,4S)-3-bromo-4-phenyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazole |
| InChIKey | XZVHYPKKENGTGN-DOMZBBRYSA-N |
| SMILES | C1[C@H]([C@@H](N2C3=CC=CC=C3N=C2S1)C4=CC=CC=C4)Br |
Computed by PubChem (NCBI)