CAS 750570-81-1 appears in our catalog under these names: 3-Bromo-4-phenyl-3,4-dihydro-2h-[1,3]thiazino[3,2-a]benzimidazole, 95%, 12-Bromo-13-phenyl-10-thia-1,8-diazatricyclo(7.4.0.0,2,7)trideca-2,4,6,8-tetraene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
3-bromo-4-phenyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazole (CAS 750570-81-1) is a chemical compound with the molecular formula C16H13BrN2S and a molecular weight of 345.3 g/mol. IUPAC name: 3-bromo-4-phenyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazole. InChIKey: XZVHYPKKENGTGN-UHFFFAOYSA-N.
| Molecular formula | C16H13BrN2S |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | 3-bromo-4-phenyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazole |
| InChIKey | XZVHYPKKENGTGN-UHFFFAOYSA-N |
| SMILES | C1C(C(N2C3=CC=CC=C3N=C2S1)C4=CC=CC=C4)Br |
Computed by PubChem (NCBI)