12H-Dibenzo[b,h]fluoren-12-one, 98%
cas: 53223-75-9 — see every product listed under this CAS number, including other names
12H-Dibenzo[b,h]fluoren-12-one, 98% (CAS 53223-75-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1912242-25mg |
| cas | 53223-75-9 |
| size | 25mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 503.88 Pln | |
| Ambeed | 50mg | 798.69 Pln | |
| Ambeed | 100mg | 1304.88 Pln | |
| Ambeed | 250mg | 2289.44 Pln | |
| Ambeed | 1g | 6044.12 Pln | |
| BLDpharm | 25mg | 536.50 Pln | |
| BLDpharm | 50mg | 858.61 Pln | |
| BLDpharm | 100mg | 1397.31 Pln | |
| BLDpharm | 250mg | 2458.05 Pln | |
| BLDpharm | 1g | 6512.18 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaen-12-one (CAS 53223-75-9) is a chemical compound with the molecular formula C21H12O and a molecular weight of 280.3 g/mol. IUPAC name: pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaen-12-one. InChIKey: JZNRMTLFMCNYBH-UHFFFAOYSA-N.
| Molecular formula | C21H12O |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaen-12-one |
| InChIKey | JZNRMTLFMCNYBH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C4=CC5=CC=CC=C5C=C4C3=O |
Computed by PubChem (NCBI)