CAS 86853-99-8 appears in our catalog under these names: 13H-Indeno[1,2-b]anthracen-13-one 95%, 13H-Indeno[1,2-b]anthracen-13-one, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaen-10-one (CAS 86853-99-8) is a chemical compound with the molecular formula C21H12O and a molecular weight of 280.3 g/mol. IUPAC name: pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaen-10-one. InChIKey: ZOJQJBDYIMQYET-UHFFFAOYSA-N.
| Molecular formula | C21H12O |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaen-10-one |
| InChIKey | ZOJQJBDYIMQYET-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C=C4C(=CC3=CC2=C1)C5=CC=CC=C5C4=O |
Computed by PubChem (NCBI)