CAS 53223-75-9 is the registry number for 12H-Dibenzo[b,h]fluoren-12-one 98%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
Pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaen-12-one (CAS 53223-75-9) is a chemical compound with the molecular formula C21H12O and a molecular weight of 280.3 g/mol. IUPAC name: pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaen-12-one. InChIKey: JZNRMTLFMCNYBH-UHFFFAOYSA-N.
| Molecular formula | C21H12O |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaen-12-one |
| InChIKey | JZNRMTLFMCNYBH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C4=CC5=CC=CC=C5C=C4C3=O |
Computed by PubChem (NCBI)