Products 1808990-94-4
CAS 1808990-94-4 appears in our catalog under these names: Cyromazine-13C3, 13C3-Cyromazine, Concentration: 100 µg/ml Solvent: Methanol, 13C3-Cyromazine. Offered by: MedChemExpress, HPC Standards. Available pack sizes: 5mg, 1mg, 1x1ml, 1x10mg.
2-N-cyclopropyl-(2,4,6-13C3)1,3,5-triazine-2,4,6-triamine (CAS 1808990-94-4) is a chemical compound with the molecular formula C6H10N6 and a molecular weight of 169.16 g/mol. IUPAC name: 2-N-cyclopropyl-(2,4,6-13C3)1,3,5-triazine-2,4,6-triamine. InChIKey: LVQDKIWDGQRHTE-VMGGCIAMSA-N.
| Molecular formula | C6H10N6 |
|---|---|
| Molecular weight | 169.16 g/mol |
| IUPAC name | 2-N-cyclopropyl-(2,4,6-13C3)1,3,5-triazine-2,4,6-triamine |
| InChIKey | LVQDKIWDGQRHTE-VMGGCIAMSA-N |
| SMILES | C1CC1N[13C]2=N[13C](=N[13C](=N2)N)N |
Computed by PubChem (NCBI)