cas: 375-82-6 — see every product listed under this CAS number, including other names
1H,1H-Perfluoroheptan-1-ol 97% (CAS 375-82-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A630819-1g |
| cas | 375-82-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 398.19 Pln | |
| Ambeed | 25g | 1432.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A630819 |
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-ol (CAS 375-82-6) is a chemical compound with the molecular formula C7H3F13O and a molecular weight of 350.08 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-ol. InChIKey: STLNAVFVCIRZLL-UHFFFAOYSA-N.
| Molecular formula | C7H3F13O |
|---|---|
| Molecular weight | 350.08 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-ol |
| InChIKey | STLNAVFVCIRZLL-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)