Products 1184-97-0
CAS 1184-97-0 is the registry number for 1,1,2,3,3,3-Hexafluoropropyl 1h,1h-heptafluorobutyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,1,1,2,2,3,3-heptafluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)butane (CAS 1184-97-0) is a chemical compound with the molecular formula C7H3F13O and a molecular weight of 350.08 g/mol. IUPAC name: 1,1,1,2,2,3,3-heptafluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)butane. InChIKey: ITRARIZTIUSJFX-UHFFFAOYSA-N.
| Molecular formula | C7H3F13O |
|---|---|
| Molecular weight | 350.08 g/mol |
| IUPAC name | 1,1,1,2,2,3,3-heptafluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)butane |
| InChIKey | ITRARIZTIUSJFX-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)F)(F)F)(F)F)OC(C(C(F)(F)F)F)(F)F |
Computed by PubChem (NCBI)