cas: 1257651-13-0 — see every product listed under this CAS number, including other names
1H-Benzo[d][1,2,3]triazol-5-ylboronic acid, pinacol ester 96% (CAS 1257651-13-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A560106-100mg |
| cas | 1257651-13-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 464.94 Pln | |
| Ambeed | 250mg | 731.94 Pln | |
| Ambeed | 1g | 1861.13 Pln | |
| Ambeed | 5g | 5599.12 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A560106 |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzotriazole (CAS 1257651-13-0) is a chemical compound with the molecular formula C12H16BN3O2 and a molecular weight of 245.09 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzotriazole. InChIKey: QUYDCPHDUNQFKF-UHFFFAOYSA-N.
| Molecular formula | C12H16BN3O2 |
|---|---|
| Molecular weight | 245.09 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzotriazole |
| InChIKey | QUYDCPHDUNQFKF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=NNN=C3C=C2 |
Computed by PubChem (NCBI)